C19H30O — CID 126609950
[3-[(2S)-2-methylbutyl]phenoxy]methylcycloheptane (PubChem CID 126609950) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is [3-[(2S)-2-methylbutyl]phenoxy]methylcycloheptane.
| Compound Name | [3-[(2S)-2-methylbutyl]phenoxy]methylcycloheptane |
|---|---|
| PubChem CID | 126609950 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | [3-[(2S)-2-methylbutyl]phenoxy]methylcycloheptane |
| SMILES | CC[C@H](C)Cc1cccc(OCC2CCCCCC2)c1 |
| InChI | InChI=1S/C19H30O/c1-3-16(2)13-18-11-8-12-19(14-18)20-15-17-9-6-4-5-7-10-17/h8,11-12,14,16-17H,3-7,9-10,13,15H2,1-2H3/t16-/m0/s1 |
| InChIKey | MGYGDZFIPLFLQG-INIZCTEOSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |