C25H42O2 — CID 144963476
1-[1-(2-cyclohexylethoxy)-2-methylpropoxy]-4-(5-methylhexan-3-yl)benzene (PubChem CID 144963476) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 1-[1-(2-cyclohexylethoxy)-2-methylpropoxy]-4-(5-methylhexan-3-yl)benzene.
| Compound Name | 1-[1-(2-cyclohexylethoxy)-2-methylpropoxy]-4-(5-methylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 144963476 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 1-[1-(2-cyclohexylethoxy)-2-methylpropoxy]-4-(5-methylhexan-3-yl)benzene |
| SMILES | CCC(CC(C)C)c1ccc(OC(OCCC2CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C25H42O2/c1-6-22(18-19(2)3)23-12-14-24(15-13-23)27-25(20(4)5)26-17-16-21-10-8-7-9-11-21/h12-15,19-22,25H,6-11,16-18H2,1-5H3 |
| InChIKey | MRTRBPNGKILQFL-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|