C51H70O4 — CID 20758424
4-[4-(4-tert-butylphenyl)-8-[4-[1-(2-cyclohexylethoxy)ethoxy]phenyl]-6-(4-propan-2-yloxyphenyl)decan-2-yl]phenol (PubChem CID 20758424) has the molecular formula C51H70O4 and a molecular weight of 747.12 g/mol. Its IUPAC name is 4-[4-(4-tert-butylphenyl)-8-[4-[1-(2-cyclohexylethoxy)ethoxy]phenyl]-6-(4-propan-2-yloxyphenyl)decan-2-yl]phenol.
| Compound Name | 4-[4-(4-tert-butylphenyl)-8-[4-[1-(2-cyclohexylethoxy)ethoxy]phenyl]-6-(4-propan-2-yloxyphenyl)decan-2-yl]phenol |
|---|---|
| PubChem CID | 20758424 |
| Molecular Formula | C51H70O4 |
| Molecular Weight | 747.12 g/mol |
| Exact Mass | 746.53 |
| IUPAC Name | 4-[4-(4-tert-butylphenyl)-8-[4-[1-(2-cyclohexylethoxy)ethoxy]phenyl]-6-(4-propan-2-yloxyphenyl)decan-2-yl]phenol |
| SMILES | CCC(CC(CC(CC(C)c1ccc(O)cc1)c1ccc(C(C)(C)C)cc1)c1ccc(OC(C)C)cc1)c1ccc(OC(C)OCCC2CCCCC2)cc1 |
| InChI | InChI=1S/C51H70O4/c1-9-40(42-19-29-50(30-20-42)55-38(5)53-32-31-39-13-11-10-12-14-39)34-46(44-21-27-49(28-22-44)54-36(2)3)35-45(33-37(4)41-17-25-48(52)26-18-41)43-15-23-47(24-16-43)51(6,7)8/h15-30,36-40,45-46,52H,9-14,31-35H2,1-8H3 |
| InChIKey | DRHUNKCXAUQGPT-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.12 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|