C39H52O6 — CID 54370516
tert-butyl [4-[6-[4-(1-cyclohexyloxyethoxy)phenyl]-2-(4-hydroxyphenyl)octan-4-yl]phenyl] carbonate (PubChem CID 54370516) has the molecular formula C39H52O6 and a molecular weight of 616.84 g/mol. Its IUPAC name is tert-butyl [4-[6-[4-(1-cyclohexyloxyethoxy)phenyl]-2-(4-hydroxyphenyl)octan-4-yl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[6-[4-(1-cyclohexyloxyethoxy)phenyl]-2-(4-hydroxyphenyl)octan-4-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 54370516 |
| Molecular Formula | C39H52O6 |
| Molecular Weight | 616.84 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | tert-butyl [4-[6-[4-(1-cyclohexyloxyethoxy)phenyl]-2-(4-hydroxyphenyl)octan-4-yl]phenyl] carbonate |
| SMILES | CCC(CC(CC(C)c1ccc(O)cc1)c1ccc(OC(=O)OC(C)(C)C)cc1)c1ccc(OC(C)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C39H52O6/c1-7-29(31-15-21-36(22-16-31)43-28(3)42-35-11-9-8-10-12-35)26-33(25-27(2)30-13-19-34(40)20-14-30)32-17-23-37(24-18-32)44-38(41)45-39(4,5)6/h13-24,27-29,33,35,40H,7-12,25-26H2,1-6H3 |
| InChIKey | USWANUSLDZHTHF-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.84 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|