C33H42O5 — CID 54252058
tert-butyl 4-[6-(4-hydroxyphenyl)-2-[4-(methoxymethoxy)phenyl]octan-4-yl]benzoate (PubChem CID 54252058) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is tert-butyl 4-[6-(4-hydroxyphenyl)-2-[4-(methoxymethoxy)phenyl]octan-4-yl]benzoate.
| Compound Name | tert-butyl 4-[6-(4-hydroxyphenyl)-2-[4-(methoxymethoxy)phenyl]octan-4-yl]benzoate |
|---|---|
| PubChem CID | 54252058 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | tert-butyl 4-[6-(4-hydroxyphenyl)-2-[4-(methoxymethoxy)phenyl]octan-4-yl]benzoate |
| SMILES | CCC(CC(CC(C)c1ccc(OCOC)cc1)c1ccc(C(=O)OC(C)(C)C)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C33H42O5/c1-7-24(26-12-16-30(34)17-13-26)21-29(20-23(2)25-14-18-31(19-15-25)37-22-36-6)27-8-10-28(11-9-27)32(35)38-33(3,4)5/h8-19,23-24,29,34H,7,20-22H2,1-6H3 |
| InChIKey | RJTDVCXSKDITKC-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|