C20H32O2 — CID 130350629
tert-butyl 4-(2,2,5-trimethylhexan-3-yl)benzoate (PubChem CID 130350629) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is tert-butyl 4-(2,2,5-trimethylhexan-3-yl)benzoate.
| Compound Name | tert-butyl 4-(2,2,5-trimethylhexan-3-yl)benzoate |
|---|---|
| PubChem CID | 130350629 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | tert-butyl 4-(2,2,5-trimethylhexan-3-yl)benzoate |
| SMILES | CC(C)CC(c1ccc(C(=O)OC(C)(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C20H32O2/c1-14(2)13-17(19(3,4)5)15-9-11-16(12-10-15)18(21)22-20(6,7)8/h9-12,14,17H,13H2,1-8H3 |
| InChIKey | LPJAFPOZRABRES-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |