C18H28O2 — CID 71131717
methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate (PubChem CID 71131717) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate.
| Compound Name | methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate |
|---|---|
| PubChem CID | 71131717 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate |
| SMILES | COC(=O)c1ccc(C(CC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O2/c1-17(2,3)12-15(18(4,5)6)13-8-10-14(11-9-13)16(19)20-7/h8-11,15H,12H2,1-7H3 |
| InChIKey | GPJAOKGCPCQDNP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |