methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate

C18H28O2 — CID 71131717

IUPACmethyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate
SMILESCOC(=O)c1ccc(C(CC(C)(C)C)C(C)(C)C)cc1
InChIInChI=1S/C18H28O2/c1-17(2,3)12-15(18(4,5)6)13-8-10-14(11-9-13)16(19)20-7/h8-11,15H,12H2,1-7H3
InChIKeyGPJAOKGCPCQDNP-UHFFFAOYSA-N
MW276.42 g/mol
LogP5.04
Rot. Bonds3

About methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate

methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate (PubChem CID 71131717) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate.

Molecular Properties

Compound Namemethyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate
PubChem CID71131717
Molecular FormulaC18H28O2
Molecular Weight276.42 g/mol
Exact Mass276.21
IUPAC Namemethyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate
SMILESCOC(=O)c1ccc(C(CC(C)(C)C)C(C)(C)C)cc1
InChIInChI=1S/C18H28O2/c1-17(2,3)12-15(18(4,5)6)13-8-10-14(11-9-13)16(19)20-7/h8-11,15H,12H2,1-7H3
InChIKeyGPJAOKGCPCQDNP-UHFFFAOYSA-N
XLogP5.04
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500276.42
LogP ≤ 55.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate?
The IUPAC name of methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate (CID 71131717) is methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate.
What is the SMILES notation for methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate?
The canonical SMILES for methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate is COC(=O)c1ccc(C(CC(C)(C)C)C(C)(C)C)cc1.
What is the InChIKey of methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate?
The InChIKey is GPJAOKGCPCQDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-17(2,3)12-15(18(4,5)6)13-8-10-14(11-9-13)16(19)20-7/h8-11,15H,12H2,1-7H3.
What are the key properties of methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate?
methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate has a molecular weight of 276.42 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,2,5,5-tetramethylhexan-3-yl)benzoate is sourced from PubChem (CID 71131717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).