C15H22ClNO2 — CID 89368906
methyl 4-[(1R)-1-(chloroamino)-4,4-dimethylpentyl]benzoate (PubChem CID 89368906) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is methyl 4-[(1R)-1-(chloroamino)-4,4-dimethylpentyl]benzoate.
| Compound Name | methyl 4-[(1R)-1-(chloroamino)-4,4-dimethylpentyl]benzoate |
|---|---|
| PubChem CID | 89368906 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | methyl 4-[(1R)-1-(chloroamino)-4,4-dimethylpentyl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H](CCC(C)(C)C)NCl)cc1 |
| InChI | InChI=1S/C15H22ClNO2/c1-15(2,3)10-9-13(17-16)11-5-7-12(8-6-11)14(18)19-4/h5-8,13,17H,9-10H2,1-4H3/t13-/m1/s1 |
| InChIKey | RGMJEASLTANIRB-CYBMUJFWSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|