C21H34O3 — CID 123886025
1-methoxyethyl 4-(2,2,5,5-tetramethylheptan-4-yl)benzoate (PubChem CID 123886025) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1-methoxyethyl 4-(2,2,5,5-tetramethylheptan-4-yl)benzoate.
| Compound Name | 1-methoxyethyl 4-(2,2,5,5-tetramethylheptan-4-yl)benzoate |
|---|---|
| PubChem CID | 123886025 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1-methoxyethyl 4-(2,2,5,5-tetramethylheptan-4-yl)benzoate |
| SMILES | CCC(C)(C)C(CC(C)(C)C)c1ccc(C(=O)OC(C)OC)cc1 |
| InChI | InChI=1S/C21H34O3/c1-9-21(6,7)18(14-20(3,4)5)16-10-12-17(13-11-16)19(22)24-15(2)23-8/h10-13,15,18H,9,14H2,1-8H3 |
| InChIKey | HLYBDRRROITRBH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|