About 1-methoxypropan-2-yl 4-tert-butylbenzoate
1-methoxypropan-2-yl 4-tert-butylbenzoate (PubChem CID 90150933) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 4-tert-butylbenzoate |
| PubChem CID | 90150933 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-methoxypropan-2-yl 4-tert-butylbenzoate |
| SMILES | COCC(C)OC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22O3/c1-11(10-17-5)18-14(16)12-6-8-13(9-7-12)15(2,3)4/h6-9,11H,10H2,1-5H3 |
| InChIKey | BJRMPDQKXHJKKR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxypropan-2-yl 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 4-tert-butylbenzoate?
The IUPAC name of 1-methoxypropan-2-yl 4-tert-butylbenzoate (CID 90150933) is 1-methoxypropan-2-yl 4-tert-butylbenzoate.
What is the SMILES notation for 1-methoxypropan-2-yl 4-tert-butylbenzoate?
The canonical SMILES for 1-methoxypropan-2-yl 4-tert-butylbenzoate is COCC(C)OC(=O)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 1-methoxypropan-2-yl 4-tert-butylbenzoate?
The InChIKey is BJRMPDQKXHJKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-11(10-17-5)18-14(16)12-6-8-13(9-7-12)15(2,3)4/h6-9,11H,10H2,1-5H3.
What are the key properties of 1-methoxypropan-2-yl 4-tert-butylbenzoate?
1-methoxypropan-2-yl 4-tert-butylbenzoate has a molecular weight of 250.34 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 4-tert-butylbenzoate is sourced from PubChem (CID 90150933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).