C23H30O4 — CID 19742305
1-methoxypropan-2-yl 4-(4-hexoxyphenyl)benzoate (PubChem CID 19742305) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 4-(4-hexoxyphenyl)benzoate.
| Compound Name | 1-methoxypropan-2-yl 4-(4-hexoxyphenyl)benzoate |
|---|---|
| PubChem CID | 19742305 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-methoxypropan-2-yl 4-(4-hexoxyphenyl)benzoate |
| SMILES | CCCCCCOc1ccc(-c2ccc(C(=O)OC(C)COC)cc2)cc1 |
| InChI | InChI=1S/C23H30O4/c1-4-5-6-7-16-26-22-14-12-20(13-15-22)19-8-10-21(11-9-19)23(24)27-18(2)17-25-3/h8-15,18H,4-7,16-17H2,1-3H3 |
| InChIKey | VFERSRYXVTVUDW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|