C40H50O10 — CID 101497690
bis[2-(4-hexoxybenzoyl)oxypropyl] benzene-1,4-dicarboxylate (PubChem CID 101497690) has the molecular formula C40H50O10 and a molecular weight of 690.83 g/mol. Its IUPAC name is bis[2-(4-hexoxybenzoyl)oxypropyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[2-(4-hexoxybenzoyl)oxypropyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101497690 |
| Molecular Formula | C40H50O10 |
| Molecular Weight | 690.83 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | bis[2-(4-hexoxybenzoyl)oxypropyl] benzene-1,4-dicarboxylate |
| SMILES | CCCCCCOc1ccc(C(=O)OC(C)COC(=O)c2ccc(C(=O)OCC(C)OC(=O)c3ccc(OCCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H50O10/c1-5-7-9-11-25-45-35-21-17-33(18-22-35)39(43)49-29(3)27-47-37(41)31-13-15-32(16-14-31)38(42)48-28-30(4)50-40(44)34-19-23-36(24-20-34)46-26-12-10-8-6-2/h13-24,29-30H,5-12,25-28H2,1-4H3 |
| InChIKey | XHUMPXXAXXGXDW-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.83 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|