C72H86O12 — CID 58785846
2,3,4,5,6-pentakis[(4-tert-butylbenzoyl)oxy]hexyl 4-tert-butylbenzoate (PubChem CID 58785846) has the molecular formula C72H86O12 and a molecular weight of 1143.47 g/mol. Its IUPAC name is 2,3,4,5,6-pentakis[(4-tert-butylbenzoyl)oxy]hexyl 4-tert-butylbenzoate.
| Compound Name | 2,3,4,5,6-pentakis[(4-tert-butylbenzoyl)oxy]hexyl 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 58785846 |
| Molecular Formula | C72H86O12 |
| Molecular Weight | 1143.47 g/mol |
| Exact Mass | 1142.61 |
| IUPAC Name | 2,3,4,5,6-pentakis[(4-tert-butylbenzoyl)oxy]hexyl 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCC(OC(=O)c2ccc(C(C)(C)C)cc2)C(OC(=O)c2ccc(C(C)(C)C)cc2)C(OC(=O)c2ccc(C(C)(C)C)cc2)C(COC(=O)c2ccc(C(C)(C)C)cc2)OC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C72H86O12/c1-67(2,3)51-31-19-45(20-32-51)61(73)79-43-57(81-63(75)47-23-35-53(36-24-47)69(7,8)9)59(83-65(77)49-27-39-55(40-28-49)71(13,14)15)60(84-66(78)50-29-41-56(42-30-50)72(16,17)18)58(82-64(76)48-25-37-54(38-26-48)70(10,11)12)44-80-62(74)46-21-33-52(34-22-46)68(4,5)6/h19-42,57-60H,43-44H2,1-18H3 |
| InChIKey | VBEHICFVBWFQIE-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1143.47 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|