C41H34N2O11 — CID 10417492
[(2R,3R,4R,5R,6E)-6-amino-2,3,4,5-tetrabenzoyloxy-6-hydroxyiminohexyl] benzoate (PubChem CID 10417492) has the molecular formula C41H34N2O11 and a molecular weight of 730.73 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6E)-6-amino-2,3,4,5-tetrabenzoyloxy-6-hydroxyiminohexyl] benzoate.
| Compound Name | [(2R,3R,4R,5R,6E)-6-amino-2,3,4,5-tetrabenzoyloxy-6-hydroxyiminohexyl] benzoate |
|---|---|
| PubChem CID | 10417492 |
| Molecular Formula | C41H34N2O11 |
| Molecular Weight | 730.73 g/mol |
| Exact Mass | 730.22 |
| IUPAC Name | [(2R,3R,4R,5R,6E)-6-amino-2,3,4,5-tetrabenzoyloxy-6-hydroxyiminohexyl] benzoate |
| SMILES | NC(=NO)[C@@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@@H](COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H34N2O11/c42-36(43-49)35(54-41(48)31-24-14-5-15-25-31)34(53-40(47)30-22-12-4-13-23-30)33(52-39(46)29-20-10-3-11-21-29)32(51-38(45)28-18-8-2-9-19-28)26-50-37(44)27-16-6-1-7-17-27/h1-25,32-35,49H,26H2,(H2,42,43)/t32-,33-,34+,35+/m1/s1 |
| InChIKey | UBTXHYTZKIJDEN-WDKGQIBQSA-N |
| XLogP | 5.49 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.73 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|