C32H30O12 — CID 101473280
[(2S,3S,4R)-2,5,5-triacetyloxy-3,4-dibenzoyloxypentyl] benzoate (PubChem CID 101473280) has the molecular formula C32H30O12 and a molecular weight of 606.58 g/mol. Its IUPAC name is [(2S,3S,4R)-2,5,5-triacetyloxy-3,4-dibenzoyloxypentyl] benzoate.
| Compound Name | [(2S,3S,4R)-2,5,5-triacetyloxy-3,4-dibenzoyloxypentyl] benzoate |
|---|---|
| PubChem CID | 101473280 |
| Molecular Formula | C32H30O12 |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | [(2S,3S,4R)-2,5,5-triacetyloxy-3,4-dibenzoyloxypentyl] benzoate |
| SMILES | CC(=O)OC(OC(C)=O)[C@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)[C@H](COC(=O)c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C32H30O12/c1-20(33)40-26(19-39-29(36)23-13-7-4-8-14-23)27(43-30(37)24-15-9-5-10-16-24)28(32(41-21(2)34)42-22(3)35)44-31(38)25-17-11-6-12-18-25/h4-18,26-28,32H,19H2,1-3H3/t26-,27-,28+/m0/s1 |
| InChIKey | YLGZEPZIHXOPCI-HZFUHODCSA-N |
| XLogP | 3.68 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|