C34H31NO10 — CID 90294860
[(2R,3R,4R,5R)-6-aminooxy-3,4,5-tribenzoyloxy-1-hydroxyhexan-2-yl] benzoate (PubChem CID 90294860) has the molecular formula C34H31NO10 and a molecular weight of 613.62 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-6-aminooxy-3,4,5-tribenzoyloxy-1-hydroxyhexan-2-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-6-aminooxy-3,4,5-tribenzoyloxy-1-hydroxyhexan-2-yl] benzoate |
|---|---|
| PubChem CID | 90294860 |
| Molecular Formula | C34H31NO10 |
| Molecular Weight | 613.62 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | [(2R,3R,4R,5R)-6-aminooxy-3,4,5-tribenzoyloxy-1-hydroxyhexan-2-yl] benzoate |
| SMILES | NOC[C@@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@@H](CO)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H31NO10/c35-41-22-28(43-32(38)24-15-7-2-8-16-24)30(45-34(40)26-19-11-4-12-20-26)29(44-33(39)25-17-9-3-10-18-25)27(21-36)42-31(37)23-13-5-1-6-14-23/h1-20,27-30,36H,21-22,35H2/t27-,28-,29-,30-/m1/s1 |
| InChIKey | VVFAEUOEQCPHKR-SKKKGAJSSA-N |
| XLogP | 3.77 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|