C19H18O6 — CID 54381762
[(2R,3S)-2-benzoyloxy-1-hydroxy-5-oxopentan-3-yl] benzoate (PubChem CID 54381762) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is [(2R,3S)-2-benzoyloxy-1-hydroxy-5-oxopentan-3-yl] benzoate.
| Compound Name | [(2R,3S)-2-benzoyloxy-1-hydroxy-5-oxopentan-3-yl] benzoate |
|---|---|
| PubChem CID | 54381762 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [(2R,3S)-2-benzoyloxy-1-hydroxy-5-oxopentan-3-yl] benzoate |
| SMILES | O=CC[C@H](OC(=O)c1ccccc1)[C@@H](CO)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18O6/c20-12-11-16(24-18(22)14-7-3-1-4-8-14)17(13-21)25-19(23)15-9-5-2-6-10-15/h1-10,12,16-17,21H,11,13H2/t16-,17+/m0/s1 |
| InChIKey | VAKIVYAPPISQRI-DLBZAZTESA-N |
| XLogP | 2.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|