C17H24O3 — CID 102525258
[(2S,3S)-1-hydroxy-3,7-dimethyloct-6-en-2-yl] benzoate (PubChem CID 102525258) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(2S,3S)-1-hydroxy-3,7-dimethyloct-6-en-2-yl] benzoate.
| Compound Name | [(2S,3S)-1-hydroxy-3,7-dimethyloct-6-en-2-yl] benzoate |
|---|---|
| PubChem CID | 102525258 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(2S,3S)-1-hydroxy-3,7-dimethyloct-6-en-2-yl] benzoate |
| SMILES | CC(C)=CCC[C@H](C)[C@@H](CO)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24O3/c1-13(2)8-7-9-14(3)16(12-18)20-17(19)15-10-5-4-6-11-15/h4-6,8,10-11,14,16,18H,7,9,12H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | QRMZZDHUMFQKHO-GOEBONIOSA-N |
| XLogP | 3.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|