C16H25NO2 — CID 138630133
benzoic acid;N,6-dimethylhept-5-en-2-amine (PubChem CID 138630133) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is benzoic acid;N,6-dimethylhept-5-en-2-amine.
| Compound Name | benzoic acid;N,6-dimethylhept-5-en-2-amine |
|---|---|
| PubChem CID | 138630133 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | benzoic acid;N,6-dimethylhept-5-en-2-amine |
| SMILES | CNC(C)CCC=C(C)C.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C9H19N.C7H6O2/c1-8(2)6-5-7-9(3)10-4;8-7(9)6-4-2-1-3-5-6/h6,9-10H,5,7H2,1-4H3;1-5H,(H,8,9) |
| InChIKey | WKYXGZQEVNGPNT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|