C18H25NO2 — CID 24776967
(4S)-N-benzyl-4,8-dimethyl-2-oxonon-7-enamide (PubChem CID 24776967) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (4S)-N-benzyl-4,8-dimethyl-2-oxonon-7-enamide.
| Compound Name | (4S)-N-benzyl-4,8-dimethyl-2-oxonon-7-enamide |
|---|---|
| PubChem CID | 24776967 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (4S)-N-benzyl-4,8-dimethyl-2-oxonon-7-enamide |
| SMILES | CC(C)=CCC[C@H](C)CC(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H25NO2/c1-14(2)8-7-9-15(3)12-17(20)18(21)19-13-16-10-5-4-6-11-16/h4-6,8,10-11,15H,7,9,12-13H2,1-3H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | NJLUDNSTUAEUHA-HNNXBMFYSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|