C17H24O2 — CID 87489443
benzaldehyde;3,7-dimethyloct-6-enal (PubChem CID 87489443) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is benzaldehyde;3,7-dimethyloct-6-enal.
| Compound Name | benzaldehyde;3,7-dimethyloct-6-enal |
|---|---|
| PubChem CID | 87489443 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | benzaldehyde;3,7-dimethyloct-6-enal |
| SMILES | CC(C)=CCCC(C)CC=O.O=Cc1ccccc1 |
| InChI | InChI=1S/C10H18O.C7H6O/c1-9(2)5-4-6-10(3)7-8-11;8-6-7-4-2-1-3-5-7/h5,8,10H,4,6-7H2,1-3H3;1-6H |
| InChIKey | IALNSZFEJLJBBM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|