C17H24 — CID 175723807
[(1Z,4S)-4,8-dimethylnona-1,7-dienyl]benzene (PubChem CID 175723807) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is [(1Z,4S)-4,8-dimethylnona-1,7-dienyl]benzene.
| Compound Name | [(1Z,4S)-4,8-dimethylnona-1,7-dienyl]benzene |
|---|---|
| PubChem CID | 175723807 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | [(1Z,4S)-4,8-dimethylnona-1,7-dienyl]benzene |
| SMILES | CC(C)=CCC[C@H](C)C/C=C\c1ccccc1 |
| InChI | InChI=1S/C17H24/c1-15(2)9-7-10-16(3)11-8-14-17-12-5-4-6-13-17/h4-6,8-9,12-14,16H,7,10-11H2,1-3H3/b14-8-/t16-/m0/s1 |
| InChIKey | PSDSRUXQOPPEGQ-VCHSTOLQSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|