C15H20 — CID 123392853
4,5-dimethylhepta-1,5-dienylbenzene (PubChem CID 123392853) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 4,5-dimethylhepta-1,5-dienylbenzene.
| Compound Name | 4,5-dimethylhepta-1,5-dienylbenzene |
|---|---|
| PubChem CID | 123392853 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 4,5-dimethylhepta-1,5-dienylbenzene |
| SMILES | CC=C(C)C(C)CC=Cc1ccccc1 |
| InChI | InChI=1S/C15H20/c1-4-13(2)14(3)9-8-12-15-10-6-5-7-11-15/h4-8,10-12,14H,9H2,1-3H3 |
| InChIKey | LHBNIOOKRHGNCF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|