C15H21O4P — CID 129208127
(E)-1-dimethoxyphosphoryl-3-methyl-6-phenylhex-5-en-2-one (PubChem CID 129208127) has the molecular formula C15H21O4P and a molecular weight of 296.30 g/mol. Its IUPAC name is (E)-1-dimethoxyphosphoryl-3-methyl-6-phenylhex-5-en-2-one.
| Compound Name | (E)-1-dimethoxyphosphoryl-3-methyl-6-phenylhex-5-en-2-one |
|---|---|
| PubChem CID | 129208127 |
| Molecular Formula | C15H21O4P |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (E)-1-dimethoxyphosphoryl-3-methyl-6-phenylhex-5-en-2-one |
| SMILES | COP(=O)(CC(=O)C(C)C/C=C/c1ccccc1)OC |
| InChI | InChI=1S/C15H21O4P/c1-13(15(16)12-20(17,18-2)19-3)8-7-11-14-9-5-4-6-10-14/h4-7,9-11,13H,8,12H2,1-3H3/b11-7+ |
| InChIKey | ZUGGDJRWPMBQGK-YRNVUSSQSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|