C20H20O2 — CID 101237032
(1E,7E)-5-hydroxy-1,8-diphenylocta-1,7-dien-4-one (PubChem CID 101237032) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1E,7E)-5-hydroxy-1,8-diphenylocta-1,7-dien-4-one.
| Compound Name | (1E,7E)-5-hydroxy-1,8-diphenylocta-1,7-dien-4-one |
|---|---|
| PubChem CID | 101237032 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (1E,7E)-5-hydroxy-1,8-diphenylocta-1,7-dien-4-one |
| SMILES | O=C(C/C=C/c1ccccc1)C(O)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H20O2/c21-19(15-7-13-17-9-3-1-4-10-17)20(22)16-8-14-18-11-5-2-6-12-18/h1-14,19,21H,15-16H2/b13-7+,14-8+ |
| InChIKey | UBBFOYRKCNCCGZ-FNCQTZNRSA-N |
| XLogP | 4.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |