About (1E,5E)-1-phenylhepta-1,5-dien-4-ol
(1E,5E)-1-phenylhepta-1,5-dien-4-ol (PubChem CID 100975516) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is (1E,5E)-1-phenylhepta-1,5-dien-4-ol.
Molecular Properties
| Compound Name | (1E,5E)-1-phenylhepta-1,5-dien-4-ol |
| PubChem CID | 100975516 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (1E,5E)-1-phenylhepta-1,5-dien-4-ol |
| SMILES | C/C=C/C(O)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-2-7-13(14)11-6-10-12-8-4-3-5-9-12/h2-10,13-14H,11H2,1H3/b7-2+,10-6+ |
| InChIKey | JVJLJVZQRHINDT-FOYBORQGSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E,5E)-1-phenylhepta-1,5-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,5E)-1-phenylhepta-1,5-dien-4-ol?
The IUPAC name of (1E,5E)-1-phenylhepta-1,5-dien-4-ol (CID 100975516) is (1E,5E)-1-phenylhepta-1,5-dien-4-ol.
What is the SMILES notation for (1E,5E)-1-phenylhepta-1,5-dien-4-ol?
The canonical SMILES for (1E,5E)-1-phenylhepta-1,5-dien-4-ol is C/C=C/C(O)C/C=C/c1ccccc1.
What is the InChIKey of (1E,5E)-1-phenylhepta-1,5-dien-4-ol?
The InChIKey is JVJLJVZQRHINDT-FOYBORQGSA-N. The full InChI is InChI=1S/C13H16O/c1-2-7-13(14)11-6-10-12-8-4-3-5-9-12/h2-10,13-14H,11H2,1H3/b7-2+,10-6+.
What are the key properties of (1E,5E)-1-phenylhepta-1,5-dien-4-ol?
(1E,5E)-1-phenylhepta-1,5-dien-4-ol has a molecular weight of 188.27 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,5E)-1-phenylhepta-1,5-dien-4-ol is sourced from PubChem (CID 100975516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).