C19H20O2 — CID 122402908
(1E,3R,5S,6E)-1,7-diphenylhepta-1,6-diene-3,5-diol (PubChem CID 122402908) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (1E,3R,5S,6E)-1,7-diphenylhepta-1,6-diene-3,5-diol.
| Compound Name | (1E,3R,5S,6E)-1,7-diphenylhepta-1,6-diene-3,5-diol |
|---|---|
| PubChem CID | 122402908 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (1E,3R,5S,6E)-1,7-diphenylhepta-1,6-diene-3,5-diol |
| SMILES | O[C@H](/C=C/c1ccccc1)C[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H20O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-14,18-21H,15H2/b13-11+,14-12+/t18-,19+ |
| InChIKey | ADTKEJDQRVBCJP-FMJVWVELSA-N |
| XLogP | 3.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |