C14H18O4 — CID 54384932
methyl (3R,5S)-3,5-dihydroxy-7-phenylhept-6-enoate (PubChem CID 54384932) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is methyl (3R,5S)-3,5-dihydroxy-7-phenylhept-6-enoate.
| Compound Name | methyl (3R,5S)-3,5-dihydroxy-7-phenylhept-6-enoate |
|---|---|
| PubChem CID | 54384932 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | methyl (3R,5S)-3,5-dihydroxy-7-phenylhept-6-enoate |
| SMILES | COC(=O)C[C@H](O)C[C@H](O)C=Cc1ccccc1 |
| InChI | InChI=1S/C14H18O4/c1-18-14(17)10-13(16)9-12(15)8-7-11-5-3-2-4-6-11/h2-8,12-13,15-16H,9-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | VCNWJEZPTFGKLI-CHWSQXEVSA-N |
| XLogP | 1.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |