C10H9Br3O — CID 129409004
(E,2S)-1,1,1-tribromo-4-phenylbut-3-en-2-ol (PubChem CID 129409004) has the molecular formula C10H9Br3O and a molecular weight of 384.89 g/mol. Its IUPAC name is (E,2S)-1,1,1-tribromo-4-phenylbut-3-en-2-ol.
| Compound Name | (E,2S)-1,1,1-tribromo-4-phenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 129409004 |
| Molecular Formula | C10H9Br3O |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 381.82 |
| IUPAC Name | (E,2S)-1,1,1-tribromo-4-phenylbut-3-en-2-ol |
| SMILES | O[C@@H](/C=C/c1ccccc1)C(Br)(Br)Br |
| InChI | InChI=1S/C10H9Br3O/c11-10(12,13)9(14)7-6-8-4-2-1-3-5-8/h1-7,9,14H/b7-6+/t9-/m0/s1 |
| InChIKey | NEZZTBRYQPJRFN-UCUJLANTSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|