C22H19FO5S2 — CID 54762908
(E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-ol (PubChem CID 54762908) has the molecular formula C22H19FO5S2 and a molecular weight of 446.52 g/mol. Its IUPAC name is (E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-ol.
| Compound Name | (E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 54762908 |
| Molecular Formula | C22H19FO5S2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (E)-1,1-bis(benzenesulfonyl)-1-fluoro-4-phenylbut-3-en-2-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(C(O)/C=C/c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19FO5S2/c23-22(29(25,26)19-12-6-2-7-13-19,30(27,28)20-14-8-3-9-15-20)21(24)17-16-18-10-4-1-5-11-18/h1-17,21,24H/b17-16+ |
| InChIKey | XYQOZOPZTLZDBK-WUKNDPDISA-N |
| XLogP | 3.63 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |