C21H22O2 — CID 153310935
(1E,6E)-5-hydroxy-4,4-dimethyl-1,7-diphenylhepta-1,6-dien-3-one (PubChem CID 153310935) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (1E,6E)-5-hydroxy-4,4-dimethyl-1,7-diphenylhepta-1,6-dien-3-one.
| Compound Name | (1E,6E)-5-hydroxy-4,4-dimethyl-1,7-diphenylhepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 153310935 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (1E,6E)-5-hydroxy-4,4-dimethyl-1,7-diphenylhepta-1,6-dien-3-one |
| SMILES | CC(C)(C(=O)/C=C/c1ccccc1)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H22O2/c1-21(2,19(22)15-13-17-9-5-3-6-10-17)20(23)16-14-18-11-7-4-8-12-18/h3-16,19,22H,1-2H3/b15-13+,16-14+ |
| InChIKey | AAIPYBLHECWJAL-WXUKJITCSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|