C10H12O — CID 11457765
(Z,2R)-4-phenylbut-3-en-2-ol (PubChem CID 11457765) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is (Z,2R)-4-phenylbut-3-en-2-ol.
| Compound Name | (Z,2R)-4-phenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 11457765 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (Z,2R)-4-phenylbut-3-en-2-ol |
| SMILES | C[C@@H](O)/C=C\c1ccccc1 |
| InChI | InChI=1S/C10H12O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-9,11H,1H3/b8-7-/t9-/m1/s1 |
| InChIKey | ZIJWGEHOVHJHKB-UFGYOYAJSA-N |
| XLogP | 2.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |