C11H12F2 — CID 132509961
[(E)-4,4-difluoro-3-methylbut-1-enyl]benzene (PubChem CID 132509961) has the molecular formula C11H12F2 and a molecular weight of 182.21 g/mol. Its IUPAC name is [(E)-4,4-difluoro-3-methylbut-1-enyl]benzene.
| Compound Name | [(E)-4,4-difluoro-3-methylbut-1-enyl]benzene |
|---|---|
| PubChem CID | 132509961 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | [(E)-4,4-difluoro-3-methylbut-1-enyl]benzene |
| SMILES | CC(/C=C/c1ccccc1)C(F)F |
| InChI | InChI=1S/C11H12F2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10/h2-9,11H,1H3/b8-7+ |
| InChIKey | JAKGHMOPQBILKX-BQYQJAHWSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |