C17H16F2 — CID 132509962
[(E)-3-benzyl-4,4-difluorobut-1-enyl]benzene (PubChem CID 132509962) has the molecular formula C17H16F2 and a molecular weight of 258.31 g/mol. Its IUPAC name is [(E)-3-benzyl-4,4-difluorobut-1-enyl]benzene.
| Compound Name | [(E)-3-benzyl-4,4-difluorobut-1-enyl]benzene |
|---|---|
| PubChem CID | 132509962 |
| Molecular Formula | C17H16F2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [(E)-3-benzyl-4,4-difluorobut-1-enyl]benzene |
| SMILES | FC(F)C(/C=C/c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H16F2/c18-17(19)16(13-15-9-5-2-6-10-15)12-11-14-7-3-1-4-8-14/h1-12,16-17H,13H2/b12-11+ |
| InChIKey | AHSXWQKKBDVOFL-VAWYXSNFSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |