C25H27NO — CID 56588629
(E,2S,3R)-1,5-diphenyl-3-(2-phenylethylamino)pent-4-en-2-ol (PubChem CID 56588629) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (E,2S,3R)-1,5-diphenyl-3-(2-phenylethylamino)pent-4-en-2-ol.
| Compound Name | (E,2S,3R)-1,5-diphenyl-3-(2-phenylethylamino)pent-4-en-2-ol |
|---|---|
| PubChem CID | 56588629 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (E,2S,3R)-1,5-diphenyl-3-(2-phenylethylamino)pent-4-en-2-ol |
| SMILES | O[C@@H](Cc1ccccc1)[C@@H](/C=C/c1ccccc1)NCCc1ccccc1 |
| InChI | InChI=1S/C25H27NO/c27-25(20-23-14-8-3-9-15-23)24(17-16-21-10-4-1-5-11-21)26-19-18-22-12-6-2-7-13-22/h1-17,24-27H,18-20H2/b17-16+/t24-,25+/m1/s1 |
| InChIKey | UNDDMQPNYBZNHS-KLXHEQSOSA-N |
| XLogP | 4.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |