C20H25NO4 — CID 135004799
(E,2R,3R,4S,5S)-5-(benzylamino)-7-phenylhept-6-ene-1,2,3,4-tetrol (PubChem CID 135004799) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (E,2R,3R,4S,5S)-5-(benzylamino)-7-phenylhept-6-ene-1,2,3,4-tetrol.
| Compound Name | (E,2R,3R,4S,5S)-5-(benzylamino)-7-phenylhept-6-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 135004799 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (E,2R,3R,4S,5S)-5-(benzylamino)-7-phenylhept-6-ene-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)[C@H](/C=C/c1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C20H25NO4/c22-14-18(23)20(25)19(24)17(12-11-15-7-3-1-4-8-15)21-13-16-9-5-2-6-10-16/h1-12,17-25H,13-14H2/b12-11+/t17-,18+,19-,20-/m0/s1 |
| InChIKey | KKKDNDQBOQEYIR-BPIHNVTPSA-N |
| XLogP | 0.93 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |