C13H19NO6 — CID 144649374
(2R,3R,4S,5R)-2-(benzylamino)-3,4,5,6-tetrahydroxyhexanoic acid (PubChem CID 144649374) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(benzylamino)-3,4,5,6-tetrahydroxyhexanoic acid.
| Compound Name | (2R,3R,4S,5R)-2-(benzylamino)-3,4,5,6-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 144649374 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-(benzylamino)-3,4,5,6-tetrahydroxyhexanoic acid |
| SMILES | O=C(O)[C@H](NCc1ccccc1)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H19NO6/c15-7-9(16)11(17)12(18)10(13(19)20)14-6-8-4-2-1-3-5-8/h1-5,9-12,14-18H,6-7H2,(H,19,20)/t9-,10-,11-,12-/m1/s1 |
| InChIKey | UFIBRFNQURVSSO-DDHJBXDOSA-N |
| XLogP | -1.70 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |