C11H17NO2 — CID 130641208
(2S,3R)-3-(benzylamino)butane-1,2-diol (PubChem CID 130641208) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (2S,3R)-3-(benzylamino)butane-1,2-diol.
| Compound Name | (2S,3R)-3-(benzylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 130641208 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2S,3R)-3-(benzylamino)butane-1,2-diol |
| SMILES | C[C@@H](NCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C11H17NO2/c1-9(11(14)8-13)12-7-10-5-3-2-4-6-10/h2-6,9,11-14H,7-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | VEDXGJGLCVTINW-MWLCHTKSSA-N |
| XLogP | 0.52 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |