C13H21N — CID 28611871
(2S,3R)-N-benzyl-3-methylpentan-2-amine (PubChem CID 28611871) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (2S,3R)-N-benzyl-3-methylpentan-2-amine.
| Compound Name | (2S,3R)-N-benzyl-3-methylpentan-2-amine |
|---|---|
| PubChem CID | 28611871 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (2S,3R)-N-benzyl-3-methylpentan-2-amine |
| SMILES | CC[C@@H](C)[C@H](C)NCc1ccccc1 |
| InChI | InChI=1S/C13H21N/c1-4-11(2)12(3)14-10-13-8-6-5-7-9-13/h5-9,11-12,14H,4,10H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | QVYAZIIADKRQGY-NEPJUHHUSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |