C14H23N — CID 28615648
(2S,3S)-3-methyl-N-(2-phenylethyl)pentan-2-amine (PubChem CID 28615648) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is (2S,3S)-3-methyl-N-(2-phenylethyl)pentan-2-amine.
| Compound Name | (2S,3S)-3-methyl-N-(2-phenylethyl)pentan-2-amine |
|---|---|
| PubChem CID | 28615648 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (2S,3S)-3-methyl-N-(2-phenylethyl)pentan-2-amine |
| SMILES | CC[C@H](C)[C@H](C)NCCc1ccccc1 |
| InChI | InChI=1S/C14H23N/c1-4-12(2)13(3)15-11-10-14-8-6-5-7-9-14/h5-9,12-13,15H,4,10-11H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | JKCQWOIIBNUNIJ-STQMWFEESA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |