C12H20N2 — CID 28672035
(2S,3S)-3-methyl-N-(pyridin-3-ylmethyl)pentan-2-amine (PubChem CID 28672035) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (2S,3S)-3-methyl-N-(pyridin-3-ylmethyl)pentan-2-amine.
| Compound Name | (2S,3S)-3-methyl-N-(pyridin-3-ylmethyl)pentan-2-amine |
|---|---|
| PubChem CID | 28672035 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (2S,3S)-3-methyl-N-(pyridin-3-ylmethyl)pentan-2-amine |
| SMILES | CC[C@H](C)[C@H](C)NCc1cccnc1 |
| InChI | InChI=1S/C12H20N2/c1-4-10(2)11(3)14-9-12-6-5-7-13-8-12/h5-8,10-11,14H,4,9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | RHUOLRQPIBBDSJ-QWRGUYRKSA-N |
| XLogP | 2.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |