C9H15N3 — CID 104868129
(2R)-2-N-(pyridin-3-ylmethyl)propane-1,2-diamine (PubChem CID 104868129) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is (2R)-2-N-(pyridin-3-ylmethyl)propane-1,2-diamine.
| Compound Name | (2R)-2-N-(pyridin-3-ylmethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 104868129 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (2R)-2-N-(pyridin-3-ylmethyl)propane-1,2-diamine |
| SMILES | C[C@H](CN)NCc1cccnc1 |
| InChI | InChI=1S/C9H15N3/c1-8(5-10)12-7-9-3-2-4-11-6-9/h2-4,6,8,12H,5,7,10H2,1H3/t8-/m1/s1 |
| InChIKey | OFSLHONOVZPYMU-MRVPVSSYSA-N |
| XLogP | 0.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |