C12H17F3N2 — CID 116534120
6,6,6-trifluoro-N-(pyridin-3-ylmethyl)hexan-2-amine (PubChem CID 116534120) has the molecular formula C12H17F3N2 and a molecular weight of 246.28 g/mol. Its IUPAC name is 6,6,6-trifluoro-N-(pyridin-3-ylmethyl)hexan-2-amine.
| Compound Name | 6,6,6-trifluoro-N-(pyridin-3-ylmethyl)hexan-2-amine |
|---|---|
| PubChem CID | 116534120 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 6,6,6-trifluoro-N-(pyridin-3-ylmethyl)hexan-2-amine |
| SMILES | CC(CCCC(F)(F)F)NCc1cccnc1 |
| InChI | InChI=1S/C12H17F3N2/c1-10(4-2-6-12(13,14)15)17-9-11-5-3-7-16-8-11/h3,5,7-8,10,17H,2,4,6,9H2,1H3 |
| InChIKey | YNJVLJBZRPMVMX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |