C15H16F2N2 — CID 54864314
1-(2,6-difluorophenyl)-N-(pyridin-3-ylmethyl)propan-2-amine (PubChem CID 54864314) has the molecular formula C15H16F2N2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-(pyridin-3-ylmethyl)propan-2-amine.
| Compound Name | 1-(2,6-difluorophenyl)-N-(pyridin-3-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 54864314 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-(pyridin-3-ylmethyl)propan-2-amine |
| SMILES | CC(Cc1c(F)cccc1F)NCc1cccnc1 |
| InChI | InChI=1S/C15H16F2N2/c1-11(19-10-12-4-3-7-18-9-12)8-13-14(16)5-2-6-15(13)17/h2-7,9,11,19H,8,10H2,1H3 |
| InChIKey | XDIRBMHPKDWGMV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |