C14H15F2NO — CID 63000728
1-(2,6-difluorophenyl)-N-(furan-3-ylmethyl)propan-2-amine (PubChem CID 63000728) has the molecular formula C14H15F2NO and a molecular weight of 251.28 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-(furan-3-ylmethyl)propan-2-amine.
| Compound Name | 1-(2,6-difluorophenyl)-N-(furan-3-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 63000728 |
| Molecular Formula | C14H15F2NO |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-(furan-3-ylmethyl)propan-2-amine |
| SMILES | CC(Cc1c(F)cccc1F)NCc1ccoc1 |
| InChI | InChI=1S/C14H15F2NO/c1-10(17-8-11-5-6-18-9-11)7-12-13(15)3-2-4-14(12)16/h2-6,9-10,17H,7-8H2,1H3 |
| InChIKey | DUQRVEPSWSZLMV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |