C17H16F2N2 — CID 60942834
3-[[1-(2,6-difluorophenyl)propan-2-ylamino]methyl]benzonitrile (PubChem CID 60942834) has the molecular formula C17H16F2N2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-[[1-(2,6-difluorophenyl)propan-2-ylamino]methyl]benzonitrile.
| Compound Name | 3-[[1-(2,6-difluorophenyl)propan-2-ylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 60942834 |
| Molecular Formula | C17H16F2N2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 3-[[1-(2,6-difluorophenyl)propan-2-ylamino]methyl]benzonitrile |
| SMILES | CC(Cc1c(F)cccc1F)NCc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H16F2N2/c1-12(8-15-16(18)6-3-7-17(15)19)21-11-14-5-2-4-13(9-14)10-20/h2-7,9,12,21H,8,11H2,1H3 |
| InChIKey | WHXYHQIVAYKITF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |