C16H14F2N2 — CID 43433776
3-[[1-(2,5-difluorophenyl)ethylamino]methyl]benzonitrile (PubChem CID 43433776) has the molecular formula C16H14F2N2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-[[1-(2,5-difluorophenyl)ethylamino]methyl]benzonitrile.
| Compound Name | 3-[[1-(2,5-difluorophenyl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 43433776 |
| Molecular Formula | C16H14F2N2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-[[1-(2,5-difluorophenyl)ethylamino]methyl]benzonitrile |
| SMILES | CC(NCc1cccc(C#N)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H14F2N2/c1-11(15-8-14(17)5-6-16(15)18)20-10-13-4-2-3-12(7-13)9-19/h2-8,11,20H,10H2,1H3 |
| InChIKey | YAVUVEVTVHEVMG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |