C13H19NO5 — CID 89051975
(2S,3R,4S,5R)-2-(benzylamino)-3,4,5,6-tetrahydroxyhexanal (PubChem CID 89051975) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(benzylamino)-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2S,3R,4S,5R)-2-(benzylamino)-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 89051975 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (2S,3R,4S,5R)-2-(benzylamino)-3,4,5,6-tetrahydroxyhexanal |
| SMILES | O=C[C@@H](NCc1ccccc1)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H19NO5/c15-7-10(12(18)13(19)11(17)8-16)14-6-9-4-2-1-3-5-9/h1-5,7,10-14,16-19H,6,8H2/t10-,11-,12-,13-/m1/s1 |
| InChIKey | IXIOMOUZILFSDC-FDYHWXHSSA-N |
| XLogP | -1.58 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|