C14H21NO6 — CID 25224466
(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[1-(2-hydroxyphenyl)ethylamino]hexanal (PubChem CID 25224466) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[1-(2-hydroxyphenyl)ethylamino]hexanal.
| Compound Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[1-(2-hydroxyphenyl)ethylamino]hexanal |
|---|---|
| PubChem CID | 25224466 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[1-(2-hydroxyphenyl)ethylamino]hexanal |
| SMILES | CC(N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)c1ccccc1O |
| InChI | InChI=1S/C14H21NO6/c1-8(9-4-2-3-5-11(9)18)15-10(6-16)13(20)14(21)12(19)7-17/h2-6,8,10,12-15,17-21H,7H2,1H3/t8?,10-,12+,13+,14+/m0/s1 |
| InChIKey | WBWZPDKTGGGGFG-SSMFCHLKSA-N |
| XLogP | -1.31 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|