C16H30N2O12 — CID 87277694
N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide (PubChem CID 87277694) has the molecular formula C16H30N2O12 and a molecular weight of 442.42 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 87277694 |
| Molecular Formula | C16H30N2O12 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO.CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C8H15NO6/c2*1-4(12)9-5(2-10)7(14)8(15)6(13)3-11/h2*2,5-8,11,13-15H,3H2,1H3,(H,9,12)/t2*5-,6+,7+,8+/m00/s1 |
| InChIKey | IVBHOTIWIXBPPD-NMGUCVMZSA-N |
| XLogP | -6.47 |
| TPSA | 254.18 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | -6.47 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|